About 1H-furo[2,3-d]imidazole
1H-furo[2,3-d]imidazole (PubChem CID 19385647) has the molecular formula C5H4N2O
and a molecular weight of 108.10 g/mol. Its IUPAC name is 1H-furo[2,3-d]imidazole.
Molecular Properties
| Compound Name | 1H-furo[2,3-d]imidazole |
| PubChem CID | 19385647 |
| Molecular Formula | C5H4N2O |
| Molecular Weight | 108.10 g/mol |
| Exact Mass | 108.03 |
| IUPAC Name | 1H-furo[2,3-d]imidazole |
| SMILES | c1nc2occc2[nH]1 |
| InChI | InChI=1S/C5H4N2O/c1-2-8-5-4(1)6-3-7-5/h1-3H,(H,6,7) |
| InChIKey | BLXHRZZPODXIEQ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.10 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-furo[2,3-d]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-furo[2,3-d]imidazole?
The IUPAC name of 1H-furo[2,3-d]imidazole (CID 19385647) is 1H-furo[2,3-d]imidazole.
What is the SMILES notation for 1H-furo[2,3-d]imidazole?
The canonical SMILES for 1H-furo[2,3-d]imidazole is c1nc2occc2[nH]1.
What is the InChIKey of 1H-furo[2,3-d]imidazole?
The InChIKey is BLXHRZZPODXIEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N2O/c1-2-8-5-4(1)6-3-7-5/h1-3H,(H,6,7).
What are the key properties of 1H-furo[2,3-d]imidazole?
1H-furo[2,3-d]imidazole has a molecular weight of 108.10 g/mol, XLogP of 1.16, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-furo[2,3-d]imidazole is sourced from PubChem (CID 19385647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).