About 4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-N-propylaniline
4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-N-propylaniline (PubChem CID 19385717) has the molecular formula C20H26N4
and a molecular weight of 322.46 g/mol. Its IUPAC name is 4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-N-propylaniline.
Molecular Properties
| Compound Name | 4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-N-propylaniline |
| PubChem CID | 19385717 |
| Molecular Formula | C20H26N4 |
| Molecular Weight | 322.46 g/mol |
| Exact Mass | 322.22 |
| IUPAC Name | 4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-N-propylaniline |
| SMILES | CCCNc1ccc(Cn2c(CC)nc3c(C)cc(C)nc32)cc1 |
| InChI | InChI=1S/C20H26N4/c1-5-11-21-17-9-7-16(8-10-17)13-24-18(6-2)23-19-14(3)12-15(4)22-20(19)24/h7-10,12,21H,5-6,11,13H2,1-4H3 |
| InChIKey | JXQQSPORZWCYEZ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.46 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-N-propylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-N-propylaniline?
The IUPAC name of 4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-N-propylaniline (CID 19385717) is 4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-N-propylaniline.
What is the SMILES notation for 4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-N-propylaniline?
The canonical SMILES for 4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-N-propylaniline is CCCNc1ccc(Cn2c(CC)nc3c(C)cc(C)nc32)cc1.
What is the InChIKey of 4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-N-propylaniline?
The InChIKey is JXQQSPORZWCYEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26N4/c1-5-11-21-17-9-7-16(8-10-17)13-24-18(6-2)23-19-14(3)12-15(4)22-20(19)24/h7-10,12,21H,5-6,11,13H2,1-4H3.
What are the key properties of 4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-N-propylaniline?
4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-N-propylaniline has a molecular weight of 322.46 g/mol, XLogP of 4.48, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-N-propylaniline is sourced from PubChem (CID 19385717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).