C25H48N4O4 — CID 19385945
methyl N-[3-[methoxycarbonyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]propyl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamate (PubChem CID 19385945) has the molecular formula C25H48N4O4 and a molecular weight of 468.68 g/mol. Its IUPAC name is methyl N-[3-[methoxycarbonyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]propyl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamate.
| Compound Name | methyl N-[3-[methoxycarbonyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]propyl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamate |
|---|---|
| PubChem CID | 19385945 |
| Molecular Formula | C25H48N4O4 |
| Molecular Weight | 468.68 g/mol |
| Exact Mass | 468.37 |
| IUPAC Name | methyl N-[3-[methoxycarbonyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]propyl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamate |
| SMILES | COC(=O)N(CCCN(C(=O)OC)C1CC(C)(C)NC(C)(C)C1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C25H48N4O4/c1-22(2)14-18(15-23(3,4)26-22)28(20(30)32-9)12-11-13-29(21(31)33-10)19-16-24(5,6)27-25(7,8)17-19/h18-19,26-27H,11-17H2,1-10H3 |
| InChIKey | KXPPNQMIUMEVNF-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.68 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |