C17H22F3NO5S — CID 19386056
[6-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate (PubChem CID 19386056) has the molecular formula C17H22F3NO5S and a molecular weight of 409.43 g/mol. Its IUPAC name is [6-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate.
| Compound Name | [6-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 19386056 |
| Molecular Formula | C17H22F3NO5S |
| Molecular Weight | 409.43 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | [6-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)OC(=O)NCC1CCc2cc(OS(=O)(=O)C(F)(F)F)ccc2C1 |
| InChI | InChI=1S/C17H22F3NO5S/c1-16(2,3)25-15(22)21-10-11-4-5-13-9-14(7-6-12(13)8-11)26-27(23,24)17(18,19)20/h6-7,9,11H,4-5,8,10H2,1-3H3,(H,21,22) |
| InChIKey | OUQICZUFZWPMMD-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.43 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|