About 5-[2-(5-butyl-1,3-dioxan-2-yl)ethynyl]-2-[4-(trifluoromethoxy)phenyl]pyridine
5-[2-(5-butyl-1,3-dioxan-2-yl)ethynyl]-2-[4-(trifluoromethoxy)phenyl]pyridine (PubChem CID 19386394) has the molecular formula C22H22F3NO3
and a molecular weight of 405.42 g/mol. Its IUPAC name is 5-[2-(5-butyl-1,3-dioxan-2-yl)ethynyl]-2-[4-(trifluoromethoxy)phenyl]pyridine.
Molecular Properties
| Compound Name | 5-[2-(5-butyl-1,3-dioxan-2-yl)ethynyl]-2-[4-(trifluoromethoxy)phenyl]pyridine |
| PubChem CID | 19386394 |
| Molecular Formula | C22H22F3NO3 |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 5-[2-(5-butyl-1,3-dioxan-2-yl)ethynyl]-2-[4-(trifluoromethoxy)phenyl]pyridine |
| SMILES | CCCCC1COC(C#Cc2ccc(-c3ccc(OC(F)(F)F)cc3)nc2)OC1 |
| InChI | InChI=1S/C22H22F3NO3/c1-2-3-4-17-14-27-21(28-15-17)12-6-16-5-11-20(26-13-16)18-7-9-19(10-8-18)29-22(23,24)25/h5,7-11,13,17,21H,2-4,14-15H2,1H3 |
| InChIKey | GGWYXWIOIDXNSN-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[2-(5-butyl-1,3-dioxan-2-yl)ethynyl]-2-[4-(trifluoromethoxy)phenyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(5-butyl-1,3-dioxan-2-yl)ethynyl]-2-[4-(trifluoromethoxy)phenyl]pyridine?
The IUPAC name of 5-[2-(5-butyl-1,3-dioxan-2-yl)ethynyl]-2-[4-(trifluoromethoxy)phenyl]pyridine (CID 19386394) is 5-[2-(5-butyl-1,3-dioxan-2-yl)ethynyl]-2-[4-(trifluoromethoxy)phenyl]pyridine.
What is the SMILES notation for 5-[2-(5-butyl-1,3-dioxan-2-yl)ethynyl]-2-[4-(trifluoromethoxy)phenyl]pyridine?
The canonical SMILES for 5-[2-(5-butyl-1,3-dioxan-2-yl)ethynyl]-2-[4-(trifluoromethoxy)phenyl]pyridine is CCCCC1COC(C#Cc2ccc(-c3ccc(OC(F)(F)F)cc3)nc2)OC1.
What is the InChIKey of 5-[2-(5-butyl-1,3-dioxan-2-yl)ethynyl]-2-[4-(trifluoromethoxy)phenyl]pyridine?
The InChIKey is GGWYXWIOIDXNSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22F3NO3/c1-2-3-4-17-14-27-21(28-15-17)12-6-16-5-11-20(26-13-16)18-7-9-19(10-8-18)29-22(23,24)25/h5,7-11,13,17,21H,2-4,14-15H2,1H3.
What are the key properties of 5-[2-(5-butyl-1,3-dioxan-2-yl)ethynyl]-2-[4-(trifluoromethoxy)phenyl]pyridine?
5-[2-(5-butyl-1,3-dioxan-2-yl)ethynyl]-2-[4-(trifluoromethoxy)phenyl]pyridine has a molecular weight of 405.42 g/mol, XLogP of 5.18, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(5-butyl-1,3-dioxan-2-yl)ethynyl]-2-[4-(trifluoromethoxy)phenyl]pyridine is sourced from PubChem (CID 19386394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).