About 5-[2-(5-propyl-1,3-dioxan-2-yl)ethynyl]-2-[4-(trifluoromethoxy)phenyl]pyridine
5-[2-(5-propyl-1,3-dioxan-2-yl)ethynyl]-2-[4-(trifluoromethoxy)phenyl]pyridine (PubChem CID 19386418) has the molecular formula C21H20F3NO3
and a molecular weight of 391.39 g/mol. Its IUPAC name is 5-[2-(5-propyl-1,3-dioxan-2-yl)ethynyl]-2-[4-(trifluoromethoxy)phenyl]pyridine.
Molecular Properties
| Compound Name | 5-[2-(5-propyl-1,3-dioxan-2-yl)ethynyl]-2-[4-(trifluoromethoxy)phenyl]pyridine |
| PubChem CID | 19386418 |
| Molecular Formula | C21H20F3NO3 |
| Molecular Weight | 391.39 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 5-[2-(5-propyl-1,3-dioxan-2-yl)ethynyl]-2-[4-(trifluoromethoxy)phenyl]pyridine |
| SMILES | CCCC1COC(C#Cc2ccc(-c3ccc(OC(F)(F)F)cc3)nc2)OC1 |
| InChI | InChI=1S/C21H20F3NO3/c1-2-3-16-13-26-20(27-14-16)11-5-15-4-10-19(25-12-15)17-6-8-18(9-7-17)28-21(22,23)24/h4,6-10,12,16,20H,2-3,13-14H2,1H3 |
| InChIKey | FUZZZDQLRIXBCM-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.39 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[2-(5-propyl-1,3-dioxan-2-yl)ethynyl]-2-[4-(trifluoromethoxy)phenyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(5-propyl-1,3-dioxan-2-yl)ethynyl]-2-[4-(trifluoromethoxy)phenyl]pyridine?
The IUPAC name of 5-[2-(5-propyl-1,3-dioxan-2-yl)ethynyl]-2-[4-(trifluoromethoxy)phenyl]pyridine (CID 19386418) is 5-[2-(5-propyl-1,3-dioxan-2-yl)ethynyl]-2-[4-(trifluoromethoxy)phenyl]pyridine.
What is the SMILES notation for 5-[2-(5-propyl-1,3-dioxan-2-yl)ethynyl]-2-[4-(trifluoromethoxy)phenyl]pyridine?
The canonical SMILES for 5-[2-(5-propyl-1,3-dioxan-2-yl)ethynyl]-2-[4-(trifluoromethoxy)phenyl]pyridine is CCCC1COC(C#Cc2ccc(-c3ccc(OC(F)(F)F)cc3)nc2)OC1.
What is the InChIKey of 5-[2-(5-propyl-1,3-dioxan-2-yl)ethynyl]-2-[4-(trifluoromethoxy)phenyl]pyridine?
The InChIKey is FUZZZDQLRIXBCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20F3NO3/c1-2-3-16-13-26-20(27-14-16)11-5-15-4-10-19(25-12-15)17-6-8-18(9-7-17)28-21(22,23)24/h4,6-10,12,16,20H,2-3,13-14H2,1H3.
What are the key properties of 5-[2-(5-propyl-1,3-dioxan-2-yl)ethynyl]-2-[4-(trifluoromethoxy)phenyl]pyridine?
5-[2-(5-propyl-1,3-dioxan-2-yl)ethynyl]-2-[4-(trifluoromethoxy)phenyl]pyridine has a molecular weight of 391.39 g/mol, XLogP of 4.79, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(5-propyl-1,3-dioxan-2-yl)ethynyl]-2-[4-(trifluoromethoxy)phenyl]pyridine is sourced from PubChem (CID 19386418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).