C22H21F2NO2 — CID 19386484
2-(3,4-difluorophenyl)-5-[2-[5-[(E)-pent-1-enyl]-1,3-dioxan-2-yl]ethynyl]pyridine (PubChem CID 19386484) has the molecular formula C22H21F2NO2 and a molecular weight of 369.41 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-5-[2-[5-[(E)-pent-1-enyl]-1,3-dioxan-2-yl]ethynyl]pyridine.
| Compound Name | 2-(3,4-difluorophenyl)-5-[2-[5-[(E)-pent-1-enyl]-1,3-dioxan-2-yl]ethynyl]pyridine |
|---|---|
| PubChem CID | 19386484 |
| Molecular Formula | C22H21F2NO2 |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 2-(3,4-difluorophenyl)-5-[2-[5-[(E)-pent-1-enyl]-1,3-dioxan-2-yl]ethynyl]pyridine |
| SMILES | CCC/C=C/C1COC(C#Cc2ccc(-c3ccc(F)c(F)c3)nc2)OC1 |
| InChI | InChI=1S/C22H21F2NO2/c1-2-3-4-5-17-14-26-22(27-15-17)11-7-16-6-10-21(25-13-16)18-8-9-19(23)20(24)12-18/h4-6,8-10,12-13,17,22H,2-3,14-15H2,1H3/b5-4+ |
| InChIKey | SVVGDFRWYWOYLJ-SNAWJCMRSA-N |
| XLogP | 4.72 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|