About 4-(4-aminophenyl)aniline;2-chlorophenol
4-(4-aminophenyl)aniline;2-chlorophenol (PubChem CID 19386561) has the molecular formula C18H17ClN2O
and a molecular weight of 312.80 g/mol. Its IUPAC name is 4-(4-aminophenyl)aniline;2-chlorophenol.
Molecular Properties
| Compound Name | 4-(4-aminophenyl)aniline;2-chlorophenol |
| PubChem CID | 19386561 |
| Molecular Formula | C18H17ClN2O |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 4-(4-aminophenyl)aniline;2-chlorophenol |
| SMILES | Nc1ccc(-c2ccc(N)cc2)cc1.Oc1ccccc1Cl |
| InChI | InChI=1S/C12H12N2.C6H5ClO/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10;7-5-3-1-2-4-6(5)8/h1-8H,13-14H2;1-4,8H |
| InChIKey | DLBNJGHWLFGEFN-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-aminophenyl)aniline;2-chlorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-aminophenyl)aniline;2-chlorophenol?
The IUPAC name of 4-(4-aminophenyl)aniline;2-chlorophenol (CID 19386561) is 4-(4-aminophenyl)aniline;2-chlorophenol.
What is the SMILES notation for 4-(4-aminophenyl)aniline;2-chlorophenol?
The canonical SMILES for 4-(4-aminophenyl)aniline;2-chlorophenol is Nc1ccc(-c2ccc(N)cc2)cc1.Oc1ccccc1Cl.
What is the InChIKey of 4-(4-aminophenyl)aniline;2-chlorophenol?
The InChIKey is DLBNJGHWLFGEFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2.C6H5ClO/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10;7-5-3-1-2-4-6(5)8/h1-8H,13-14H2;1-4,8H.
What are the key properties of 4-(4-aminophenyl)aniline;2-chlorophenol?
4-(4-aminophenyl)aniline;2-chlorophenol has a molecular weight of 312.80 g/mol, XLogP of 4.56, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-aminophenyl)aniline;2-chlorophenol is sourced from PubChem (CID 19386561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).