C23H18F5N3O5 — CID 19386940
N-[[2,2-dimethyl-6-nitro-4-(3-oxo-1H-isoindol-2-yl)chromen-3-yl]methyl]-2,2,3,3,3-pentafluoropropanamide (PubChem CID 19386940) has the molecular formula C23H18F5N3O5 and a molecular weight of 511.40 g/mol. Its IUPAC name is N-[[2,2-dimethyl-6-nitro-4-(3-oxo-1H-isoindol-2-yl)chromen-3-yl]methyl]-2,2,3,3,3-pentafluoropropanamide.
| Compound Name | N-[[2,2-dimethyl-6-nitro-4-(3-oxo-1H-isoindol-2-yl)chromen-3-yl]methyl]-2,2,3,3,3-pentafluoropropanamide |
|---|---|
| PubChem CID | 19386940 |
| Molecular Formula | C23H18F5N3O5 |
| Molecular Weight | 511.40 g/mol |
| Exact Mass | 511.12 |
| IUPAC Name | N-[[2,2-dimethyl-6-nitro-4-(3-oxo-1H-isoindol-2-yl)chromen-3-yl]methyl]-2,2,3,3,3-pentafluoropropanamide |
| SMILES | CC1(C)Oc2ccc([N+](=O)[O-])cc2C(N2Cc3ccccc3C2=O)=C1CNC(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C23H18F5N3O5/c1-21(2)16(10-29-20(33)22(24,25)23(26,27)28)18(15-9-13(31(34)35)7-8-17(15)36-21)30-11-12-5-3-4-6-14(12)19(30)32/h3-9H,10-11H2,1-2H3,(H,29,33) |
| InChIKey | NLUXINCGRUPPSX-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.40 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|