C22H18F3N3O5 — CID 19386998
N-[[2,2-dimethyl-6-nitro-4-(3-oxo-1H-isoindol-2-yl)chromen-3-yl]methyl]-2,2,2-trifluoroacetamide (PubChem CID 19386998) has the molecular formula C22H18F3N3O5 and a molecular weight of 461.40 g/mol. Its IUPAC name is N-[[2,2-dimethyl-6-nitro-4-(3-oxo-1H-isoindol-2-yl)chromen-3-yl]methyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[[2,2-dimethyl-6-nitro-4-(3-oxo-1H-isoindol-2-yl)chromen-3-yl]methyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 19386998 |
| Molecular Formula | C22H18F3N3O5 |
| Molecular Weight | 461.40 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | N-[[2,2-dimethyl-6-nitro-4-(3-oxo-1H-isoindol-2-yl)chromen-3-yl]methyl]-2,2,2-trifluoroacetamide |
| SMILES | CC1(C)Oc2ccc([N+](=O)[O-])cc2C(N2Cc3ccccc3C2=O)=C1CNC(=O)C(F)(F)F |
| InChI | InChI=1S/C22H18F3N3O5/c1-21(2)16(10-26-20(30)22(23,24)25)18(15-9-13(28(31)32)7-8-17(15)33-21)27-11-12-5-3-4-6-14(12)19(27)29/h3-9H,10-11H2,1-2H3,(H,26,30) |
| InChIKey | LBIUWXHVZGCGLV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.40 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|