C26H27F5N2O2 — CID 19387014
2-[3-(diethylaminomethyl)-2,2-dimethyl-6-(1,1,2,2,2-pentafluoroethyl)chromen-4-yl]-3H-isoindol-1-one (PubChem CID 19387014) has the molecular formula C26H27F5N2O2 and a molecular weight of 494.50 g/mol. Its IUPAC name is 2-[3-(diethylaminomethyl)-2,2-dimethyl-6-(1,1,2,2,2-pentafluoroethyl)chromen-4-yl]-3H-isoindol-1-one.
| Compound Name | 2-[3-(diethylaminomethyl)-2,2-dimethyl-6-(1,1,2,2,2-pentafluoroethyl)chromen-4-yl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 19387014 |
| Molecular Formula | C26H27F5N2O2 |
| Molecular Weight | 494.50 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | 2-[3-(diethylaminomethyl)-2,2-dimethyl-6-(1,1,2,2,2-pentafluoroethyl)chromen-4-yl]-3H-isoindol-1-one |
| SMILES | CCN(CC)CC1=C(N2Cc3ccccc3C2=O)c2cc(C(F)(F)C(F)(F)F)ccc2OC1(C)C |
| InChI | InChI=1S/C26H27F5N2O2/c1-5-32(6-2)15-20-22(33-14-16-9-7-8-10-18(16)23(33)34)19-13-17(25(27,28)26(29,30)31)11-12-21(19)35-24(20,3)4/h7-13H,5-6,14-15H2,1-4H3 |
| InChIKey | RAWHLDWESHWOAZ-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.50 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|