C21H19F5N2O4 — CID 19387224
methyl N-[[2,2-dimethyl-4-(2-oxo-1-pyridinyl)-6-(1,1,2,2,2-pentafluoroethyl)chromen-3-yl]methyl]carbamate (PubChem CID 19387224) has the molecular formula C21H19F5N2O4 and a molecular weight of 458.38 g/mol. Its IUPAC name is methyl N-[[2,2-dimethyl-4-(2-oxo-1-pyridinyl)-6-(1,1,2,2,2-pentafluoroethyl)chromen-3-yl]methyl]carbamate.
| Compound Name | methyl N-[[2,2-dimethyl-4-(2-oxo-1-pyridinyl)-6-(1,1,2,2,2-pentafluoroethyl)chromen-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 19387224 |
| Molecular Formula | C21H19F5N2O4 |
| Molecular Weight | 458.38 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | methyl N-[[2,2-dimethyl-4-(2-oxo-1-pyridinyl)-6-(1,1,2,2,2-pentafluoroethyl)chromen-3-yl]methyl]carbamate |
| SMILES | COC(=O)NCC1=C(n2ccccc2=O)c2cc(C(F)(F)C(F)(F)F)ccc2OC1(C)C |
| InChI | InChI=1S/C21H19F5N2O4/c1-19(2)14(11-27-18(30)31-3)17(28-9-5-4-6-16(28)29)13-10-12(7-8-15(13)32-19)20(22,23)21(24,25)26/h4-10H,11H2,1-3H3,(H,27,30) |
| InChIKey | ISPJZUCTSMFDQC-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.38 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|