C20H16F5N3O5 — CID 19387280
N-[[2,2-dimethyl-6-nitro-4-(2-oxo-1-pyridinyl)chromen-3-yl]methyl]-2,2,3,3,3-pentafluoropropanamide (PubChem CID 19387280) has the molecular formula C20H16F5N3O5 and a molecular weight of 473.35 g/mol. Its IUPAC name is N-[[2,2-dimethyl-6-nitro-4-(2-oxo-1-pyridinyl)chromen-3-yl]methyl]-2,2,3,3,3-pentafluoropropanamide.
| Compound Name | N-[[2,2-dimethyl-6-nitro-4-(2-oxo-1-pyridinyl)chromen-3-yl]methyl]-2,2,3,3,3-pentafluoropropanamide |
|---|---|
| PubChem CID | 19387280 |
| Molecular Formula | C20H16F5N3O5 |
| Molecular Weight | 473.35 g/mol |
| Exact Mass | 473.10 |
| IUPAC Name | N-[[2,2-dimethyl-6-nitro-4-(2-oxo-1-pyridinyl)chromen-3-yl]methyl]-2,2,3,3,3-pentafluoropropanamide |
| SMILES | CC1(C)Oc2ccc([N+](=O)[O-])cc2C(n2ccccc2=O)=C1CNC(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C20H16F5N3O5/c1-18(2)13(10-26-17(30)19(21,22)20(23,24)25)16(27-8-4-3-5-15(27)29)12-9-11(28(31)32)6-7-14(12)33-18/h3-9H,10H2,1-2H3,(H,26,30) |
| InChIKey | WAJJQXHBRVCKCD-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 103.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.35 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|