C25H43NO7 — CID 19387509
1-adamantyl(1,4,7,10,13,16-hexaoxa-19-azacyclohenicos-19-yl)methanone (PubChem CID 19387509) has the molecular formula C25H43NO7 and a molecular weight of 469.62 g/mol. Its IUPAC name is 1-adamantyl(1,4,7,10,13,16-hexaoxa-19-azacyclohenicos-19-yl)methanone.
| Compound Name | 1-adamantyl(1,4,7,10,13,16-hexaoxa-19-azacyclohenicos-19-yl)methanone |
|---|---|
| PubChem CID | 19387509 |
| Molecular Formula | C25H43NO7 |
| Molecular Weight | 469.62 g/mol |
| Exact Mass | 469.30 |
| IUPAC Name | 1-adamantyl(1,4,7,10,13,16-hexaoxa-19-azacyclohenicos-19-yl)methanone |
| SMILES | O=C(N1CCOCCOCCOCCOCCOCCOCC1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C25H43NO7/c27-24(25-18-21-15-22(19-25)17-23(16-21)20-25)26-1-3-28-5-7-30-9-11-32-13-14-33-12-10-31-8-6-29-4-2-26/h21-23H,1-20H2 |
| InChIKey | MZBYPYSGVGPWAY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 75.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.62 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |