C18H26O — CID 19387563
6-butyl-2-(4-methoxyphenyl)spiro[3.3]heptane (PubChem CID 19387563) has the molecular formula C18H26O and a molecular weight of 258.40 g/mol. Its IUPAC name is 6-butyl-2-(4-methoxyphenyl)spiro[3.3]heptane.
| Compound Name | 6-butyl-2-(4-methoxyphenyl)spiro[3.3]heptane |
|---|---|
| PubChem CID | 19387563 |
| Molecular Formula | C18H26O |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | 6-butyl-2-(4-methoxyphenyl)spiro[3.3]heptane |
| SMILES | CCCCC1CC2(C1)CC(c1ccc(OC)cc1)C2 |
| InChI | InChI=1S/C18H26O/c1-3-4-5-14-10-18(11-14)12-16(13-18)15-6-8-17(19-2)9-7-15/h6-9,14,16H,3-5,10-13H2,1-2H3 |
| InChIKey | YIAAOMLCVGSMLK-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |