About 2-sulfanyl-3H-1,2-benzoxazole
2-sulfanyl-3H-1,2-benzoxazole (PubChem CID 19388214) has the molecular formula C7H7NOS
and a molecular weight of 153.21 g/mol. Its IUPAC name is 2-sulfanyl-3H-1,2-benzoxazole.
Molecular Properties
| Compound Name | 2-sulfanyl-3H-1,2-benzoxazole |
| PubChem CID | 19388214 |
| Molecular Formula | C7H7NOS |
| Molecular Weight | 153.21 g/mol |
| Exact Mass | 153.02 |
| IUPAC Name | 2-sulfanyl-3H-1,2-benzoxazole |
| SMILES | SN1Cc2ccccc2O1 |
| InChI | InChI=1S/C7H7NOS/c10-8-5-6-3-1-2-4-7(6)9-8/h1-4,10H,5H2 |
| InChIKey | RDYKWJVOECRBJA-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 12.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.21 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-sulfanyl-3H-1,2-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-sulfanyl-3H-1,2-benzoxazole?
The IUPAC name of 2-sulfanyl-3H-1,2-benzoxazole (CID 19388214) is 2-sulfanyl-3H-1,2-benzoxazole.
What is the SMILES notation for 2-sulfanyl-3H-1,2-benzoxazole?
The canonical SMILES for 2-sulfanyl-3H-1,2-benzoxazole is SN1Cc2ccccc2O1.
What is the InChIKey of 2-sulfanyl-3H-1,2-benzoxazole?
The InChIKey is RDYKWJVOECRBJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NOS/c10-8-5-6-3-1-2-4-7(6)9-8/h1-4,10H,5H2.
What are the key properties of 2-sulfanyl-3H-1,2-benzoxazole?
2-sulfanyl-3H-1,2-benzoxazole has a molecular weight of 153.21 g/mol, XLogP of 1.64, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfanyl-3H-1,2-benzoxazole is sourced from PubChem (CID 19388214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).