About 4-ethenyl-2,2-dipropyl-1,3-dioxolane
4-ethenyl-2,2-dipropyl-1,3-dioxolane (PubChem CID 19388279) has the molecular formula C11H20O2
and a molecular weight of 184.28 g/mol. Its IUPAC name is 4-ethenyl-2,2-dipropyl-1,3-dioxolane.
Molecular Properties
| Compound Name | 4-ethenyl-2,2-dipropyl-1,3-dioxolane |
| PubChem CID | 19388279 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | 4-ethenyl-2,2-dipropyl-1,3-dioxolane |
| SMILES | C=CC1COC(CCC)(CCC)O1 |
| InChI | InChI=1S/C11H20O2/c1-4-7-11(8-5-2)12-9-10(6-3)13-11/h6,10H,3-5,7-9H2,1-2H3 |
| InChIKey | VWMPYOWYEJVERY-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-ethenyl-2,2-dipropyl-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenyl-2,2-dipropyl-1,3-dioxolane?
The IUPAC name of 4-ethenyl-2,2-dipropyl-1,3-dioxolane (CID 19388279) is 4-ethenyl-2,2-dipropyl-1,3-dioxolane.
What is the SMILES notation for 4-ethenyl-2,2-dipropyl-1,3-dioxolane?
The canonical SMILES for 4-ethenyl-2,2-dipropyl-1,3-dioxolane is C=CC1COC(CCC)(CCC)O1.
What is the InChIKey of 4-ethenyl-2,2-dipropyl-1,3-dioxolane?
The InChIKey is VWMPYOWYEJVERY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2/c1-4-7-11(8-5-2)12-9-10(6-3)13-11/h6,10H,3-5,7-9H2,1-2H3.
What are the key properties of 4-ethenyl-2,2-dipropyl-1,3-dioxolane?
4-ethenyl-2,2-dipropyl-1,3-dioxolane has a molecular weight of 184.28 g/mol, XLogP of 2.88, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenyl-2,2-dipropyl-1,3-dioxolane is sourced from PubChem (CID 19388279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).