C29H55N7O3 — CID 19388413
2-[1-[[4,6-bis[ethyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]oxy]ethoxy]ethanol (PubChem CID 19388413) has the molecular formula C29H55N7O3 and a molecular weight of 549.81 g/mol. Its IUPAC name is 2-[1-[[4,6-bis[ethyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]oxy]ethoxy]ethanol.
| Compound Name | 2-[1-[[4,6-bis[ethyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]oxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 19388413 |
| Molecular Formula | C29H55N7O3 |
| Molecular Weight | 549.81 g/mol |
| Exact Mass | 549.44 |
| IUPAC Name | 2-[1-[[4,6-bis[ethyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]oxy]ethoxy]ethanol |
| SMILES | CCN(c1nc(OC(C)OCCO)nc(N(CC)C2CC(C)(C)NC(C)(C)C2)n1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C29H55N7O3/c1-12-35(21-16-26(4,5)33-27(6,7)17-21)23-30-24(32-25(31-23)39-20(3)38-15-14-37)36(13-2)22-18-28(8,9)34-29(10,11)19-22/h20-22,33-34,37H,12-19H2,1-11H3 |
| InChIKey | OADMSDCAGNGLJF-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 107.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.81 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|