About 4-bromo-1H-1-benzazepine
4-bromo-1H-1-benzazepine (PubChem CID 19388528) has the molecular formula C10H8BrN
and a molecular weight of 222.09 g/mol. Its IUPAC name is 4-bromo-1H-1-benzazepine.
Molecular Properties
| Compound Name | 4-bromo-1H-1-benzazepine |
| PubChem CID | 19388528 |
| Molecular Formula | C10H8BrN |
| Molecular Weight | 222.09 g/mol |
| Exact Mass | 220.98 |
| IUPAC Name | 4-bromo-1H-1-benzazepine |
| SMILES | BrC1=Cc2ccccc2NC=C1 |
| InChI | InChI=1S/C10H8BrN/c11-9-5-6-12-10-4-2-1-3-8(10)7-9/h1-7,12H |
| InChIKey | RQDDQKMKOJBQBH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.09 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-bromo-1H-1-benzazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-1H-1-benzazepine?
The IUPAC name of 4-bromo-1H-1-benzazepine (CID 19388528) is 4-bromo-1H-1-benzazepine.
What is the SMILES notation for 4-bromo-1H-1-benzazepine?
The canonical SMILES for 4-bromo-1H-1-benzazepine is BrC1=Cc2ccccc2NC=C1.
What is the InChIKey of 4-bromo-1H-1-benzazepine?
The InChIKey is RQDDQKMKOJBQBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8BrN/c11-9-5-6-12-10-4-2-1-3-8(10)7-9/h1-7,12H.
What are the key properties of 4-bromo-1H-1-benzazepine?
4-bromo-1H-1-benzazepine has a molecular weight of 222.09 g/mol, XLogP of 3.36, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-1H-1-benzazepine is sourced from PubChem (CID 19388528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).