About 1H-imidazo[4,5-c]pyridin-4-amine;hydrochloride
1H-imidazo[4,5-c]pyridin-4-amine;hydrochloride (PubChem CID 19388577) has the molecular formula C6H7ClN4
and a molecular weight of 170.60 g/mol. Its IUPAC name is 1H-imidazo[4,5-c]pyridin-4-amine;hydrochloride.
Molecular Properties
| Compound Name | 1H-imidazo[4,5-c]pyridin-4-amine;hydrochloride |
| PubChem CID | 19388577 |
| Molecular Formula | C6H7ClN4 |
| Molecular Weight | 170.60 g/mol |
| Exact Mass | 170.04 |
| IUPAC Name | 1H-imidazo[4,5-c]pyridin-4-amine;hydrochloride |
| SMILES | Cl.Nc1nccc2[nH]cnc12 |
| InChI | InChI=1S/C6H6N4.ClH/c7-6-5-4(1-2-8-6)9-3-10-5;/h1-3H,(H2,7,8)(H,9,10);1H |
| InChIKey | QFMJVRUDZYMICQ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.60 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1H-imidazo[4,5-c]pyridin-4-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-imidazo[4,5-c]pyridin-4-amine;hydrochloride?
The IUPAC name of 1H-imidazo[4,5-c]pyridin-4-amine;hydrochloride (CID 19388577) is 1H-imidazo[4,5-c]pyridin-4-amine;hydrochloride.
What is the SMILES notation for 1H-imidazo[4,5-c]pyridin-4-amine;hydrochloride?
The canonical SMILES for 1H-imidazo[4,5-c]pyridin-4-amine;hydrochloride is Cl.Nc1nccc2[nH]cnc12.
What is the InChIKey of 1H-imidazo[4,5-c]pyridin-4-amine;hydrochloride?
The InChIKey is QFMJVRUDZYMICQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4.ClH/c7-6-5-4(1-2-8-6)9-3-10-5;/h1-3H,(H2,7,8)(H,9,10);1H.
What are the key properties of 1H-imidazo[4,5-c]pyridin-4-amine;hydrochloride?
1H-imidazo[4,5-c]pyridin-4-amine;hydrochloride has a molecular weight of 170.60 g/mol, XLogP of 0.96, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-imidazo[4,5-c]pyridin-4-amine;hydrochloride is sourced from PubChem (CID 19388577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).