About 4-(4-chlorophenyl)-3-(1,3-oxazol-5-yl)-2-(trifluoromethyl)benzamide
4-(4-chlorophenyl)-3-(1,3-oxazol-5-yl)-2-(trifluoromethyl)benzamide (PubChem CID 19388639) has the molecular formula C17H10ClF3N2O2
and a molecular weight of 366.73 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-3-(1,3-oxazol-5-yl)-2-(trifluoromethyl)benzamide.
Molecular Properties
| Compound Name | 4-(4-chlorophenyl)-3-(1,3-oxazol-5-yl)-2-(trifluoromethyl)benzamide |
| PubChem CID | 19388639 |
| Molecular Formula | C17H10ClF3N2O2 |
| Molecular Weight | 366.73 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | 4-(4-chlorophenyl)-3-(1,3-oxazol-5-yl)-2-(trifluoromethyl)benzamide |
| SMILES | NC(=O)c1ccc(-c2ccc(Cl)cc2)c(-c2cnco2)c1C(F)(F)F |
| InChI | InChI=1S/C17H10ClF3N2O2/c18-10-3-1-9(2-4-10)11-5-6-12(16(22)24)15(17(19,20)21)14(11)13-7-23-8-25-13/h1-8H,(H2,22,24) |
| InChIKey | AIXNNKCCOJIGCU-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.73 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(4-chlorophenyl)-3-(1,3-oxazol-5-yl)-2-(trifluoromethyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-chlorophenyl)-3-(1,3-oxazol-5-yl)-2-(trifluoromethyl)benzamide?
The IUPAC name of 4-(4-chlorophenyl)-3-(1,3-oxazol-5-yl)-2-(trifluoromethyl)benzamide (CID 19388639) is 4-(4-chlorophenyl)-3-(1,3-oxazol-5-yl)-2-(trifluoromethyl)benzamide.
What is the SMILES notation for 4-(4-chlorophenyl)-3-(1,3-oxazol-5-yl)-2-(trifluoromethyl)benzamide?
The canonical SMILES for 4-(4-chlorophenyl)-3-(1,3-oxazol-5-yl)-2-(trifluoromethyl)benzamide is NC(=O)c1ccc(-c2ccc(Cl)cc2)c(-c2cnco2)c1C(F)(F)F.
What is the InChIKey of 4-(4-chlorophenyl)-3-(1,3-oxazol-5-yl)-2-(trifluoromethyl)benzamide?
The InChIKey is AIXNNKCCOJIGCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10ClF3N2O2/c18-10-3-1-9(2-4-10)11-5-6-12(16(22)24)15(17(19,20)21)14(11)13-7-23-8-25-13/h1-8H,(H2,22,24).
What are the key properties of 4-(4-chlorophenyl)-3-(1,3-oxazol-5-yl)-2-(trifluoromethyl)benzamide?
4-(4-chlorophenyl)-3-(1,3-oxazol-5-yl)-2-(trifluoromethyl)benzamide has a molecular weight of 366.73 g/mol, XLogP of 4.78, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-chlorophenyl)-3-(1,3-oxazol-5-yl)-2-(trifluoromethyl)benzamide is sourced from PubChem (CID 19388639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).