About 2-aminophenol;2-hydroxybenzaldehyde
2-aminophenol;2-hydroxybenzaldehyde (PubChem CID 19389301) has the molecular formula C13H13NO3
and a molecular weight of 231.25 g/mol. Its IUPAC name is 2-aminophenol;2-hydroxybenzaldehyde.
Molecular Properties
| Compound Name | 2-aminophenol;2-hydroxybenzaldehyde |
| PubChem CID | 19389301 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 2-aminophenol;2-hydroxybenzaldehyde |
| SMILES | Nc1ccccc1O.O=Cc1ccccc1O |
| InChI | InChI=1S/C7H6O2.C6H7NO/c8-5-6-3-1-2-4-7(6)9;7-5-3-1-2-4-6(5)8/h1-5,9H;1-4,8H,7H2 |
| InChIKey | HXDBRKVFDBABBD-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-aminophenol;2-hydroxybenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminophenol;2-hydroxybenzaldehyde?
The IUPAC name of 2-aminophenol;2-hydroxybenzaldehyde (CID 19389301) is 2-aminophenol;2-hydroxybenzaldehyde.
What is the SMILES notation for 2-aminophenol;2-hydroxybenzaldehyde?
The canonical SMILES for 2-aminophenol;2-hydroxybenzaldehyde is Nc1ccccc1O.O=Cc1ccccc1O.
What is the InChIKey of 2-aminophenol;2-hydroxybenzaldehyde?
The InChIKey is HXDBRKVFDBABBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O2.C6H7NO/c8-5-6-3-1-2-4-7(6)9;7-5-3-1-2-4-6(5)8/h1-5,9H;1-4,8H,7H2.
What are the key properties of 2-aminophenol;2-hydroxybenzaldehyde?
2-aminophenol;2-hydroxybenzaldehyde has a molecular weight of 231.25 g/mol, XLogP of 2.18, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminophenol;2-hydroxybenzaldehyde is sourced from PubChem (CID 19389301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).