About [4-[tert-butyl(diphenyl)silyl]oxy-6-oxooxan-2-yl]methyl 4-methylbenzenesulfonate
[4-[tert-butyl(diphenyl)silyl]oxy-6-oxooxan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 19389484) has the molecular formula C29H34O6SSi
and a molecular weight of 538.74 g/mol. Its IUPAC name is [4-[tert-butyl(diphenyl)silyl]oxy-6-oxooxan-2-yl]methyl 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | [4-[tert-butyl(diphenyl)silyl]oxy-6-oxooxan-2-yl]methyl 4-methylbenzenesulfonate |
| PubChem CID | 19389484 |
| Molecular Formula | C29H34O6SSi |
| Molecular Weight | 538.74 g/mol |
| Exact Mass | 538.18 |
| IUPAC Name | [4-[tert-butyl(diphenyl)silyl]oxy-6-oxooxan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2CC(O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)CC(=O)O2)cc1 |
| InChI | InChI=1S/C29H34O6SSi/c1-22-15-17-25(18-16-22)36(31,32)33-21-24-19-23(20-28(30)34-24)35-37(29(2,3)4,26-11-7-5-8-12-26)27-13-9-6-10-14-27/h5-18,23-24H,19-21H2,1-4H3 |
| InChIKey | CXMPXDFWWRDBHD-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 538.74 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [4-[tert-butyl(diphenyl)silyl]oxy-6-oxooxan-2-yl]methyl 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[tert-butyl(diphenyl)silyl]oxy-6-oxooxan-2-yl]methyl 4-methylbenzenesulfonate?
The IUPAC name of [4-[tert-butyl(diphenyl)silyl]oxy-6-oxooxan-2-yl]methyl 4-methylbenzenesulfonate (CID 19389484) is [4-[tert-butyl(diphenyl)silyl]oxy-6-oxooxan-2-yl]methyl 4-methylbenzenesulfonate.
What is the SMILES notation for [4-[tert-butyl(diphenyl)silyl]oxy-6-oxooxan-2-yl]methyl 4-methylbenzenesulfonate?
The canonical SMILES for [4-[tert-butyl(diphenyl)silyl]oxy-6-oxooxan-2-yl]methyl 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OCC2CC(O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)CC(=O)O2)cc1.
What is the InChIKey of [4-[tert-butyl(diphenyl)silyl]oxy-6-oxooxan-2-yl]methyl 4-methylbenzenesulfonate?
The InChIKey is CXMPXDFWWRDBHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H34O6SSi/c1-22-15-17-25(18-16-22)36(31,32)33-21-24-19-23(20-28(30)34-24)35-37(29(2,3)4,26-11-7-5-8-12-26)27-13-9-6-10-14-27/h5-18,23-24H,19-21H2,1-4H3.
What are the key properties of [4-[tert-butyl(diphenyl)silyl]oxy-6-oxooxan-2-yl]methyl 4-methylbenzenesulfonate?
[4-[tert-butyl(diphenyl)silyl]oxy-6-oxooxan-2-yl]methyl 4-methylbenzenesulfonate has a molecular weight of 538.74 g/mol, XLogP of 4.35, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[tert-butyl(diphenyl)silyl]oxy-6-oxooxan-2-yl]methyl 4-methylbenzenesulfonate is sourced from PubChem (CID 19389484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).