C11H4F7NO2 — CID 19389555
2-(1,1,2,2,3,3,3-heptafluoropropyl)-3,1-benzoxazin-4-one (PubChem CID 19389555) has the molecular formula C11H4F7NO2 and a molecular weight of 315.14 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,3-heptafluoropropyl)-3,1-benzoxazin-4-one.
| Compound Name | 2-(1,1,2,2,3,3,3-heptafluoropropyl)-3,1-benzoxazin-4-one |
|---|---|
| PubChem CID | 19389555 |
| Molecular Formula | C11H4F7NO2 |
| Molecular Weight | 315.14 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | 2-(1,1,2,2,3,3,3-heptafluoropropyl)-3,1-benzoxazin-4-one |
| SMILES | O=c1oc(C(F)(F)C(F)(F)C(F)(F)F)nc2ccccc12 |
| InChI | InChI=1S/C11H4F7NO2/c12-9(13,10(14,15)11(16,17)18)8-19-6-4-2-1-3-5(6)7(20)21-8/h1-4H |
| InChIKey | LEJAJVFLTGIPPE-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.14 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|