C30H28O3S — CID 19390141
(E,2E)-8-methoxy-8-methyl-2-[[3-[(E)-2-(3-thiophen-3-ylphenyl)ethenyl]phenyl]methylidene]non-4-en-6-ynoic acid (PubChem CID 19390141) has the molecular formula C30H28O3S and a molecular weight of 468.62 g/mol. Its IUPAC name is (E,2E)-8-methoxy-8-methyl-2-[[3-[(E)-2-(3-thiophen-3-ylphenyl)ethenyl]phenyl]methylidene]non-4-en-6-ynoic acid.
| Compound Name | (E,2E)-8-methoxy-8-methyl-2-[[3-[(E)-2-(3-thiophen-3-ylphenyl)ethenyl]phenyl]methylidene]non-4-en-6-ynoic acid |
|---|---|
| PubChem CID | 19390141 |
| Molecular Formula | C30H28O3S |
| Molecular Weight | 468.62 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | (E,2E)-8-methoxy-8-methyl-2-[[3-[(E)-2-(3-thiophen-3-ylphenyl)ethenyl]phenyl]methylidene]non-4-en-6-ynoic acid |
| SMILES | COC(C)(C)C#C/C=C/C/C(=C\c1cccc(/C=C/c2cccc(-c3ccsc3)c2)c1)C(=O)O |
| InChI | InChI=1S/C30H28O3S/c1-30(2,33-3)17-6-4-5-12-27(29(31)32)21-25-11-7-9-23(19-25)14-15-24-10-8-13-26(20-24)28-16-18-34-22-28/h4-5,7-11,13-16,18-22H,12H2,1-3H3,(H,31,32)/b5-4+,15-14+,27-21+ |
| InChIKey | SYCBDRKUTYYDJN-ILYCNGKQSA-N |
| XLogP | 7.43 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.62 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|