About ethyl 5-carboxyoxy-2-(2,4-dichlorophenyl)-4-ethyl-3-methyl-4H-pyrazole-3-carboxylate
ethyl 5-carboxyoxy-2-(2,4-dichlorophenyl)-4-ethyl-3-methyl-4H-pyrazole-3-carboxylate (PubChem CID 19390512) has the molecular formula C16H18Cl2N2O5
and a molecular weight of 389.24 g/mol. Its IUPAC name is ethyl 5-carboxyoxy-2-(2,4-dichlorophenyl)-4-ethyl-3-methyl-4H-pyrazole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-carboxyoxy-2-(2,4-dichlorophenyl)-4-ethyl-3-methyl-4H-pyrazole-3-carboxylate |
| PubChem CID | 19390512 |
| Molecular Formula | C16H18Cl2N2O5 |
| Molecular Weight | 389.24 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | ethyl 5-carboxyoxy-2-(2,4-dichlorophenyl)-4-ethyl-3-methyl-4H-pyrazole-3-carboxylate |
| SMILES | CCOC(=O)C1(C)C(CC)C(OC(=O)O)=NN1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H18Cl2N2O5/c1-4-10-13(25-15(22)23)19-20(16(10,3)14(21)24-5-2)12-7-6-9(17)8-11(12)18/h6-8,10H,4-5H2,1-3H3,(H,22,23) |
| InChIKey | OALMTBUSYVFCNR-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.24 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 5-carboxyoxy-2-(2,4-dichlorophenyl)-4-ethyl-3-methyl-4H-pyrazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-carboxyoxy-2-(2,4-dichlorophenyl)-4-ethyl-3-methyl-4H-pyrazole-3-carboxylate?
The IUPAC name of ethyl 5-carboxyoxy-2-(2,4-dichlorophenyl)-4-ethyl-3-methyl-4H-pyrazole-3-carboxylate (CID 19390512) is ethyl 5-carboxyoxy-2-(2,4-dichlorophenyl)-4-ethyl-3-methyl-4H-pyrazole-3-carboxylate.
What is the SMILES notation for ethyl 5-carboxyoxy-2-(2,4-dichlorophenyl)-4-ethyl-3-methyl-4H-pyrazole-3-carboxylate?
The canonical SMILES for ethyl 5-carboxyoxy-2-(2,4-dichlorophenyl)-4-ethyl-3-methyl-4H-pyrazole-3-carboxylate is CCOC(=O)C1(C)C(CC)C(OC(=O)O)=NN1c1ccc(Cl)cc1Cl.
What is the InChIKey of ethyl 5-carboxyoxy-2-(2,4-dichlorophenyl)-4-ethyl-3-methyl-4H-pyrazole-3-carboxylate?
The InChIKey is OALMTBUSYVFCNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18Cl2N2O5/c1-4-10-13(25-15(22)23)19-20(16(10,3)14(21)24-5-2)12-7-6-9(17)8-11(12)18/h6-8,10H,4-5H2,1-3H3,(H,22,23).
What are the key properties of ethyl 5-carboxyoxy-2-(2,4-dichlorophenyl)-4-ethyl-3-methyl-4H-pyrazole-3-carboxylate?
ethyl 5-carboxyoxy-2-(2,4-dichlorophenyl)-4-ethyl-3-methyl-4H-pyrazole-3-carboxylate has a molecular weight of 389.24 g/mol, XLogP of 4.17, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-carboxyoxy-2-(2,4-dichlorophenyl)-4-ethyl-3-methyl-4H-pyrazole-3-carboxylate is sourced from PubChem (CID 19390512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).