C18H18F3NO6 — CID 19390665
(E)-6-[6-methoxy-7-methyl-3-oxo-4-[(2,2,2-trifluoroacetyl)amino]-1H-2-benzofuran-5-yl]hex-4-enoic acid (PubChem CID 19390665) has the molecular formula C18H18F3NO6 and a molecular weight of 401.34 g/mol. Its IUPAC name is (E)-6-[6-methoxy-7-methyl-3-oxo-4-[(2,2,2-trifluoroacetyl)amino]-1H-2-benzofuran-5-yl]hex-4-enoic acid.
| Compound Name | (E)-6-[6-methoxy-7-methyl-3-oxo-4-[(2,2,2-trifluoroacetyl)amino]-1H-2-benzofuran-5-yl]hex-4-enoic acid |
|---|---|
| PubChem CID | 19390665 |
| Molecular Formula | C18H18F3NO6 |
| Molecular Weight | 401.34 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | (E)-6-[6-methoxy-7-methyl-3-oxo-4-[(2,2,2-trifluoroacetyl)amino]-1H-2-benzofuran-5-yl]hex-4-enoic acid |
| SMILES | COc1c(C)c2c(c(NC(=O)C(F)(F)F)c1C/C=C/CCC(=O)O)C(=O)OC2 |
| InChI | InChI=1S/C18H18F3NO6/c1-9-11-8-28-16(25)13(11)14(22-17(26)18(19,20)21)10(15(9)27-2)6-4-3-5-7-12(23)24/h3-4H,5-8H2,1-2H3,(H,22,26)(H,23,24)/b4-3+ |
| InChIKey | LQSPORXMLVVDGT-ONEGZZNKSA-N |
| XLogP | 3.14 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.34 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|