About 5,7-difluoro-6-(4-methylpiperazin-1-yl)-1H-indole-2,3-dione
5,7-difluoro-6-(4-methylpiperazin-1-yl)-1H-indole-2,3-dione (PubChem CID 19390691) has the molecular formula C13H13F2N3O2
and a molecular weight of 281.26 g/mol. Its IUPAC name is 5,7-difluoro-6-(4-methylpiperazin-1-yl)-1H-indole-2,3-dione.
Molecular Properties
| Compound Name | 5,7-difluoro-6-(4-methylpiperazin-1-yl)-1H-indole-2,3-dione |
| PubChem CID | 19390691 |
| Molecular Formula | C13H13F2N3O2 |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 5,7-difluoro-6-(4-methylpiperazin-1-yl)-1H-indole-2,3-dione |
| SMILES | CN1CCN(c2c(F)cc3c(c2F)NC(=O)C3=O)CC1 |
| InChI | InChI=1S/C13H13F2N3O2/c1-17-2-4-18(5-3-17)11-8(14)6-7-10(9(11)15)16-13(20)12(7)19/h6H,2-5H2,1H3,(H,16,19,20) |
| InChIKey | LWZICSIRTZFFPZ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 5,7-difluoro-6-(4-methylpiperazin-1-yl)-1H-indole-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-difluoro-6-(4-methylpiperazin-1-yl)-1H-indole-2,3-dione?
The IUPAC name of 5,7-difluoro-6-(4-methylpiperazin-1-yl)-1H-indole-2,3-dione (CID 19390691) is 5,7-difluoro-6-(4-methylpiperazin-1-yl)-1H-indole-2,3-dione.
What is the SMILES notation for 5,7-difluoro-6-(4-methylpiperazin-1-yl)-1H-indole-2,3-dione?
The canonical SMILES for 5,7-difluoro-6-(4-methylpiperazin-1-yl)-1H-indole-2,3-dione is CN1CCN(c2c(F)cc3c(c2F)NC(=O)C3=O)CC1.
What is the InChIKey of 5,7-difluoro-6-(4-methylpiperazin-1-yl)-1H-indole-2,3-dione?
The InChIKey is LWZICSIRTZFFPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13F2N3O2/c1-17-2-4-18(5-3-17)11-8(14)6-7-10(9(11)15)16-13(20)12(7)19/h6H,2-5H2,1H3,(H,16,19,20).
What are the key properties of 5,7-difluoro-6-(4-methylpiperazin-1-yl)-1H-indole-2,3-dione?
5,7-difluoro-6-(4-methylpiperazin-1-yl)-1H-indole-2,3-dione has a molecular weight of 281.26 g/mol, XLogP of 0.85, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-difluoro-6-(4-methylpiperazin-1-yl)-1H-indole-2,3-dione is sourced from PubChem (CID 19390691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).