About tert-butyl 4-(5-fluoro-2,3-dioxo-1H-indol-6-yl)-2-methylpiperazine-1-carboxylate
tert-butyl 4-(5-fluoro-2,3-dioxo-1H-indol-6-yl)-2-methylpiperazine-1-carboxylate (PubChem CID 19390712) has the molecular formula C18H22FN3O4
and a molecular weight of 363.39 g/mol. Its IUPAC name is tert-butyl 4-(5-fluoro-2,3-dioxo-1H-indol-6-yl)-2-methylpiperazine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-(5-fluoro-2,3-dioxo-1H-indol-6-yl)-2-methylpiperazine-1-carboxylate |
| PubChem CID | 19390712 |
| Molecular Formula | C18H22FN3O4 |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | tert-butyl 4-(5-fluoro-2,3-dioxo-1H-indol-6-yl)-2-methylpiperazine-1-carboxylate |
| SMILES | CC1CN(c2cc3c(cc2F)C(=O)C(=O)N3)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H22FN3O4/c1-10-9-21(5-6-22(10)17(25)26-18(2,3)4)14-8-13-11(7-12(14)19)15(23)16(24)20-13/h7-8,10H,5-6,9H2,1-4H3,(H,20,23,24) |
| InChIKey | GCYBWCPKIHVNNQ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 4-(5-fluoro-2,3-dioxo-1H-indol-6-yl)-2-methylpiperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-(5-fluoro-2,3-dioxo-1H-indol-6-yl)-2-methylpiperazine-1-carboxylate?
The IUPAC name of tert-butyl 4-(5-fluoro-2,3-dioxo-1H-indol-6-yl)-2-methylpiperazine-1-carboxylate (CID 19390712) is tert-butyl 4-(5-fluoro-2,3-dioxo-1H-indol-6-yl)-2-methylpiperazine-1-carboxylate.
What is the SMILES notation for tert-butyl 4-(5-fluoro-2,3-dioxo-1H-indol-6-yl)-2-methylpiperazine-1-carboxylate?
The canonical SMILES for tert-butyl 4-(5-fluoro-2,3-dioxo-1H-indol-6-yl)-2-methylpiperazine-1-carboxylate is CC1CN(c2cc3c(cc2F)C(=O)C(=O)N3)CCN1C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 4-(5-fluoro-2,3-dioxo-1H-indol-6-yl)-2-methylpiperazine-1-carboxylate?
The InChIKey is GCYBWCPKIHVNNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22FN3O4/c1-10-9-21(5-6-22(10)17(25)26-18(2,3)4)14-8-13-11(7-12(14)19)15(23)16(24)20-13/h7-8,10H,5-6,9H2,1-4H3,(H,20,23,24).
What are the key properties of tert-butyl 4-(5-fluoro-2,3-dioxo-1H-indol-6-yl)-2-methylpiperazine-1-carboxylate?
tert-butyl 4-(5-fluoro-2,3-dioxo-1H-indol-6-yl)-2-methylpiperazine-1-carboxylate has a molecular weight of 363.39 g/mol, XLogP of 2.41, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-(5-fluoro-2,3-dioxo-1H-indol-6-yl)-2-methylpiperazine-1-carboxylate is sourced from PubChem (CID 19390712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).