C25H33N3O — CID 19390888
(NZ)-N-[3-(1-benzylpiperidin-4-yl)-1-(4-pyrrolidin-1-ylphenyl)propylidene]hydroxylamine (PubChem CID 19390888) has the molecular formula C25H33N3O and a molecular weight of 391.56 g/mol. Its IUPAC name is (NZ)-N-[3-(1-benzylpiperidin-4-yl)-1-(4-pyrrolidin-1-ylphenyl)propylidene]hydroxylamine.
| Compound Name | (NZ)-N-[3-(1-benzylpiperidin-4-yl)-1-(4-pyrrolidin-1-ylphenyl)propylidene]hydroxylamine |
|---|---|
| PubChem CID | 19390888 |
| Molecular Formula | C25H33N3O |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.26 |
| IUPAC Name | (NZ)-N-[3-(1-benzylpiperidin-4-yl)-1-(4-pyrrolidin-1-ylphenyl)propylidene]hydroxylamine |
| SMILES | O/N=C(/CCC1CCN(Cc2ccccc2)CC1)c1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C25H33N3O/c29-26-25(23-9-11-24(12-10-23)28-16-4-5-17-28)13-8-21-14-18-27(19-15-21)20-22-6-2-1-3-7-22/h1-3,6-7,9-12,21,29H,4-5,8,13-20H2/b26-25- |
| InChIKey | FWFNCAKKCRJCTP-QPLCGJKRSA-N |
| XLogP | 5.16 |
| TPSA | 39.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|