C12H20F5NO2 — CID 19391141
5-amino-6-cyclohexyl-1,1,1,2,2-pentafluorohexane-3,4-diol (PubChem CID 19391141) has the molecular formula C12H20F5NO2 and a molecular weight of 305.29 g/mol. Its IUPAC name is 5-amino-6-cyclohexyl-1,1,1,2,2-pentafluorohexane-3,4-diol.
| Compound Name | 5-amino-6-cyclohexyl-1,1,1,2,2-pentafluorohexane-3,4-diol |
|---|---|
| PubChem CID | 19391141 |
| Molecular Formula | C12H20F5NO2 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 5-amino-6-cyclohexyl-1,1,1,2,2-pentafluorohexane-3,4-diol |
| SMILES | NC(CC1CCCCC1)C(O)C(O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H20F5NO2/c13-11(14,12(15,16)17)10(20)9(19)8(18)6-7-4-2-1-3-5-7/h7-10,19-20H,1-6,18H2 |
| InChIKey | HZKJYPGBZWJJAI-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|