C20H27ClN4O3 — CID 19391593
4-[[4-(4-carbamimidoylphenyl)-3,6-dihydro-2H-pyridine-1-carbonyl]amino]cyclohexane-1-carboxylic acid;hydrochloride (PubChem CID 19391593) has the molecular formula C20H27ClN4O3 and a molecular weight of 406.91 g/mol. Its IUPAC name is 4-[[4-(4-carbamimidoylphenyl)-3,6-dihydro-2H-pyridine-1-carbonyl]amino]cyclohexane-1-carboxylic acid;hydrochloride.
| Compound Name | 4-[[4-(4-carbamimidoylphenyl)-3,6-dihydro-2H-pyridine-1-carbonyl]amino]cyclohexane-1-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 19391593 |
| Molecular Formula | C20H27ClN4O3 |
| Molecular Weight | 406.91 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 4-[[4-(4-carbamimidoylphenyl)-3,6-dihydro-2H-pyridine-1-carbonyl]amino]cyclohexane-1-carboxylic acid;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(C2=CCN(C(=O)NC3CCC(C(=O)O)CC3)CC2)cc1 |
| InChI | InChI=1S/C20H26N4O3.ClH/c21-18(22)15-3-1-13(2-4-15)14-9-11-24(12-10-14)20(27)23-17-7-5-16(6-8-17)19(25)26;/h1-4,9,16-17H,5-8,10-12H2,(H3,21,22)(H,23,27)(H,25,26);1H |
| InChIKey | KPPIZBQDBCBOJK-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.91 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|