C22H33N5O3 — CID 19391634
propan-2-yl 4-[[1-(5-carbamimidoyl-2-pyridinyl)piperidine-4-carbonyl]amino]cyclohexane-1-carboxylate (PubChem CID 19391634) has the molecular formula C22H33N5O3 and a molecular weight of 415.54 g/mol. Its IUPAC name is propan-2-yl 4-[[1-(5-carbamimidoyl-2-pyridinyl)piperidine-4-carbonyl]amino]cyclohexane-1-carboxylate.
| Compound Name | propan-2-yl 4-[[1-(5-carbamimidoyl-2-pyridinyl)piperidine-4-carbonyl]amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 19391634 |
| Molecular Formula | C22H33N5O3 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.26 |
| IUPAC Name | propan-2-yl 4-[[1-(5-carbamimidoyl-2-pyridinyl)piperidine-4-carbonyl]amino]cyclohexane-1-carboxylate |
| SMILES | [H]/N=C(\N)c1ccc(N2CCC(C(=O)NC3CCC(C(=O)OC(C)C)CC3)CC2)nc1 |
| InChI | InChI=1S/C22H33N5O3/c1-14(2)30-22(29)16-3-6-18(7-4-16)26-21(28)15-9-11-27(12-10-15)19-8-5-17(13-25-19)20(23)24/h5,8,13-16,18H,3-4,6-7,9-12H2,1-2H3,(H3,23,24)(H,26,28) |
| InChIKey | JFYIDHZWKUIPBC-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 121.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|