About 6-amino-3-butyl-2,4-dichlorophenol
6-amino-3-butyl-2,4-dichlorophenol (PubChem CID 19391854) has the molecular formula C10H13Cl2NO
and a molecular weight of 234.13 g/mol. Its IUPAC name is 6-amino-3-butyl-2,4-dichlorophenol.
Molecular Properties
| Compound Name | 6-amino-3-butyl-2,4-dichlorophenol |
| PubChem CID | 19391854 |
| Molecular Formula | C10H13Cl2NO |
| Molecular Weight | 234.13 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | 6-amino-3-butyl-2,4-dichlorophenol |
| SMILES | CCCCc1c(Cl)cc(N)c(O)c1Cl |
| InChI | InChI=1S/C10H13Cl2NO/c1-2-3-4-6-7(11)5-8(13)10(14)9(6)12/h5,14H,2-4,13H2,1H3 |
| InChIKey | PLPKAWJGWYLMOE-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.13 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-3-butyl-2,4-dichlorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-3-butyl-2,4-dichlorophenol?
The IUPAC name of 6-amino-3-butyl-2,4-dichlorophenol (CID 19391854) is 6-amino-3-butyl-2,4-dichlorophenol.
What is the SMILES notation for 6-amino-3-butyl-2,4-dichlorophenol?
The canonical SMILES for 6-amino-3-butyl-2,4-dichlorophenol is CCCCc1c(Cl)cc(N)c(O)c1Cl.
What is the InChIKey of 6-amino-3-butyl-2,4-dichlorophenol?
The InChIKey is PLPKAWJGWYLMOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13Cl2NO/c1-2-3-4-6-7(11)5-8(13)10(14)9(6)12/h5,14H,2-4,13H2,1H3.
What are the key properties of 6-amino-3-butyl-2,4-dichlorophenol?
6-amino-3-butyl-2,4-dichlorophenol has a molecular weight of 234.13 g/mol, XLogP of 3.62, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-3-butyl-2,4-dichlorophenol is sourced from PubChem (CID 19391854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).