About 6-acetyl-1,4-benzodioxine-2-carboxamide
6-acetyl-1,4-benzodioxine-2-carboxamide (PubChem CID 19392438) has the molecular formula C11H9NO4
and a molecular weight of 219.20 g/mol. Its IUPAC name is 6-acetyl-1,4-benzodioxine-2-carboxamide.
Molecular Properties
| Compound Name | 6-acetyl-1,4-benzodioxine-2-carboxamide |
| PubChem CID | 19392438 |
| Molecular Formula | C11H9NO4 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | 6-acetyl-1,4-benzodioxine-2-carboxamide |
| SMILES | CC(=O)c1ccc2c(c1)OC=C(C(N)=O)O2 |
| InChI | InChI=1S/C11H9NO4/c1-6(13)7-2-3-8-9(4-7)15-5-10(16-8)11(12)14/h2-5H,1H3,(H2,12,14) |
| InChIKey | XZHJYIGXBYFUPC-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-acetyl-1,4-benzodioxine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-acetyl-1,4-benzodioxine-2-carboxamide?
The IUPAC name of 6-acetyl-1,4-benzodioxine-2-carboxamide (CID 19392438) is 6-acetyl-1,4-benzodioxine-2-carboxamide.
What is the SMILES notation for 6-acetyl-1,4-benzodioxine-2-carboxamide?
The canonical SMILES for 6-acetyl-1,4-benzodioxine-2-carboxamide is CC(=O)c1ccc2c(c1)OC=C(C(N)=O)O2.
What is the InChIKey of 6-acetyl-1,4-benzodioxine-2-carboxamide?
The InChIKey is XZHJYIGXBYFUPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO4/c1-6(13)7-2-3-8-9(4-7)15-5-10(16-8)11(12)14/h2-5H,1H3,(H2,12,14).
What are the key properties of 6-acetyl-1,4-benzodioxine-2-carboxamide?
6-acetyl-1,4-benzodioxine-2-carboxamide has a molecular weight of 219.20 g/mol, XLogP of 0.99, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-acetyl-1,4-benzodioxine-2-carboxamide is sourced from PubChem (CID 19392438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).