C28H31F3N6O3 — CID 19394123
N-[3,5-dimethyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]-2-[3-(4-nitropyrazol-1-yl)-1-adamantyl]acetamide (PubChem CID 19394123) has the molecular formula C28H31F3N6O3 and a molecular weight of 556.59 g/mol. Its IUPAC name is N-[3,5-dimethyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]-2-[3-(4-nitropyrazol-1-yl)-1-adamantyl]acetamide.
| Compound Name | N-[3,5-dimethyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]-2-[3-(4-nitropyrazol-1-yl)-1-adamantyl]acetamide |
|---|---|
| PubChem CID | 19394123 |
| Molecular Formula | C28H31F3N6O3 |
| Molecular Weight | 556.59 g/mol |
| Exact Mass | 556.24 |
| IUPAC Name | N-[3,5-dimethyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]-2-[3-(4-nitropyrazol-1-yl)-1-adamantyl]acetamide |
| SMILES | Cc1nn(Cc2cccc(C(F)(F)F)c2)c(C)c1NC(=O)CC12CC3CC(C1)CC(n1cc([N+](=O)[O-])cn1)(C3)C2 |
| InChI | InChI=1S/C28H31F3N6O3/c1-17-25(18(2)35(34-17)14-19-4-3-5-22(7-19)28(29,30)31)33-24(38)12-26-8-20-6-21(9-26)11-27(10-20,16-26)36-15-23(13-32-36)37(39)40/h3-5,7,13,15,20-21H,6,8-12,14,16H2,1-2H3,(H,33,38) |
| InChIKey | OVXSNAPMYTZQKR-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.59 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|