C17H12Cl3N3O — CID 19395454
2-chloro-N-[1-[(2,6-dichlorophenyl)methyl]pyrazol-4-yl]benzamide (PubChem CID 19395454) has the molecular formula C17H12Cl3N3O and a molecular weight of 380.66 g/mol. Its IUPAC name is 2-chloro-N-[1-[(2,6-dichlorophenyl)methyl]pyrazol-4-yl]benzamide.
| Compound Name | 2-chloro-N-[1-[(2,6-dichlorophenyl)methyl]pyrazol-4-yl]benzamide |
|---|---|
| PubChem CID | 19395454 |
| Molecular Formula | C17H12Cl3N3O |
| Molecular Weight | 380.66 g/mol |
| Exact Mass | 379.00 |
| IUPAC Name | 2-chloro-N-[1-[(2,6-dichlorophenyl)methyl]pyrazol-4-yl]benzamide |
| SMILES | O=C(Nc1cnn(Cc2c(Cl)cccc2Cl)c1)c1ccccc1Cl |
| InChI | InChI=1S/C17H12Cl3N3O/c18-14-5-2-1-4-12(14)17(24)22-11-8-21-23(9-11)10-13-15(19)6-3-7-16(13)20/h1-9H,10H2,(H,22,24) |
| InChIKey | WXYXHKWARKRGFH-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.66 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |