C20H15Cl2N5O — CID 19397544
N-(1-benzylpyrazol-4-yl)-3-(2,4-dichlorophenyl)-1H-pyrazole-5-carboxamide (PubChem CID 19397544) has the molecular formula C20H15Cl2N5O and a molecular weight of 412.28 g/mol. Its IUPAC name is N-(1-benzylpyrazol-4-yl)-3-(2,4-dichlorophenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-(1-benzylpyrazol-4-yl)-3-(2,4-dichlorophenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19397544 |
| Molecular Formula | C20H15Cl2N5O |
| Molecular Weight | 412.28 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | N-(1-benzylpyrazol-4-yl)-3-(2,4-dichlorophenyl)-1H-pyrazole-5-carboxamide |
| SMILES | O=C(Nc1cnn(Cc2ccccc2)c1)c1cc(-c2ccc(Cl)cc2Cl)n[nH]1 |
| InChI | InChI=1S/C20H15Cl2N5O/c21-14-6-7-16(17(22)8-14)18-9-19(26-25-18)20(28)24-15-10-23-27(12-15)11-13-4-2-1-3-5-13/h1-10,12H,11H2,(H,24,28)(H,25,26) |
| InChIKey | FVQJALKDPYBSOH-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.28 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |