C25H22ClN3O2 — CID 19400071
3-[(2-chlorophenoxy)methyl]-N-[1-[(4-methylphenyl)methyl]pyrazol-4-yl]benzamide (PubChem CID 19400071) has the molecular formula C25H22ClN3O2 and a molecular weight of 431.92 g/mol. Its IUPAC name is 3-[(2-chlorophenoxy)methyl]-N-[1-[(4-methylphenyl)methyl]pyrazol-4-yl]benzamide.
| Compound Name | 3-[(2-chlorophenoxy)methyl]-N-[1-[(4-methylphenyl)methyl]pyrazol-4-yl]benzamide |
|---|---|
| PubChem CID | 19400071 |
| Molecular Formula | C25H22ClN3O2 |
| Molecular Weight | 431.92 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | 3-[(2-chlorophenoxy)methyl]-N-[1-[(4-methylphenyl)methyl]pyrazol-4-yl]benzamide |
| SMILES | Cc1ccc(Cn2cc(NC(=O)c3cccc(COc4ccccc4Cl)c3)cn2)cc1 |
| InChI | InChI=1S/C25H22ClN3O2/c1-18-9-11-19(12-10-18)15-29-16-22(14-27-29)28-25(30)21-6-4-5-20(13-21)17-31-24-8-3-2-7-23(24)26/h2-14,16H,15,17H2,1H3,(H,28,30) |
| InChIKey | VTOSIBCBDFKQGC-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.92 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |