C28H26ClN3O3 — CID 19400674
(E)-N-(1-benzyl-4-chloropyrazol-3-yl)-3-[4-methoxy-3-[(2-methylphenoxy)methyl]phenyl]prop-2-enamide (PubChem CID 19400674) has the molecular formula C28H26ClN3O3 and a molecular weight of 487.99 g/mol. Its IUPAC name is (E)-N-(1-benzyl-4-chloropyrazol-3-yl)-3-[4-methoxy-3-[(2-methylphenoxy)methyl]phenyl]prop-2-enamide.
| Compound Name | (E)-N-(1-benzyl-4-chloropyrazol-3-yl)-3-[4-methoxy-3-[(2-methylphenoxy)methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 19400674 |
| Molecular Formula | C28H26ClN3O3 |
| Molecular Weight | 487.99 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | (E)-N-(1-benzyl-4-chloropyrazol-3-yl)-3-[4-methoxy-3-[(2-methylphenoxy)methyl]phenyl]prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)Nc2nn(Cc3ccccc3)cc2Cl)cc1COc1ccccc1C |
| InChI | InChI=1S/C28H26ClN3O3/c1-20-8-6-7-11-25(20)35-19-23-16-21(12-14-26(23)34-2)13-15-27(33)30-28-24(29)18-32(31-28)17-22-9-4-3-5-10-22/h3-16,18H,17,19H2,1-2H3,(H,30,31,33)/b15-13+ |
| InChIKey | SPUDKUZCTZXOHN-FYWRMAATSA-N |
| XLogP | 6.13 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.99 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|