C17H18BrN5O — CID 19401719
4-bromo-1-ethyl-N-[1-[(4-methylphenyl)methyl]pyrazol-4-yl]pyrazole-3-carboxamide (PubChem CID 19401719) has the molecular formula C17H18BrN5O and a molecular weight of 388.27 g/mol. Its IUPAC name is 4-bromo-1-ethyl-N-[1-[(4-methylphenyl)methyl]pyrazol-4-yl]pyrazole-3-carboxamide.
| Compound Name | 4-bromo-1-ethyl-N-[1-[(4-methylphenyl)methyl]pyrazol-4-yl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19401719 |
| Molecular Formula | C17H18BrN5O |
| Molecular Weight | 388.27 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | 4-bromo-1-ethyl-N-[1-[(4-methylphenyl)methyl]pyrazol-4-yl]pyrazole-3-carboxamide |
| SMILES | CCn1cc(Br)c(C(=O)Nc2cnn(Cc3ccc(C)cc3)c2)n1 |
| InChI | InChI=1S/C17H18BrN5O/c1-3-22-11-15(18)16(21-22)17(24)20-14-8-19-23(10-14)9-13-6-4-12(2)5-7-13/h4-8,10-11H,3,9H2,1-2H3,(H,20,24) |
| InChIKey | JWFMCFBZWWGLDT-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.27 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |