C27H27F5N6O3 — CID 19402031
N-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]-2-[3-(4-nitropyrazol-1-yl)-1-adamantyl]acetamide (PubChem CID 19402031) has the molecular formula C27H27F5N6O3 and a molecular weight of 578.54 g/mol. Its IUPAC name is N-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]-2-[3-(4-nitropyrazol-1-yl)-1-adamantyl]acetamide.
| Compound Name | N-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]-2-[3-(4-nitropyrazol-1-yl)-1-adamantyl]acetamide |
|---|---|
| PubChem CID | 19402031 |
| Molecular Formula | C27H27F5N6O3 |
| Molecular Weight | 578.54 g/mol |
| Exact Mass | 578.21 |
| IUPAC Name | N-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]-2-[3-(4-nitropyrazol-1-yl)-1-adamantyl]acetamide |
| SMILES | Cc1nn(Cc2c(F)c(F)c(F)c(F)c2F)c(C)c1NC(=O)CC12CC3CC(C1)CC(n1cc([N+](=O)[O-])cn1)(C3)C2 |
| InChI | InChI=1S/C27H27F5N6O3/c1-13-25(14(2)36(35-13)11-18-20(28)22(30)24(32)23(31)21(18)29)34-19(39)8-26-4-15-3-16(5-26)7-27(6-15,12-26)37-10-17(9-33-37)38(40)41/h9-10,15-16H,3-8,11-12H2,1-2H3,(H,34,39) |
| InChIKey | AFTFELIZJQZRGG-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.54 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|