C23H17ClF5N5O2 — CID 19402158
1-[(3-chlorophenoxy)methyl]-N-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]pyrazole-3-carboxamide (PubChem CID 19402158) has the molecular formula C23H17ClF5N5O2 and a molecular weight of 525.87 g/mol. Its IUPAC name is 1-[(3-chlorophenoxy)methyl]-N-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]pyrazole-3-carboxamide.
| Compound Name | 1-[(3-chlorophenoxy)methyl]-N-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19402158 |
| Molecular Formula | C23H17ClF5N5O2 |
| Molecular Weight | 525.87 g/mol |
| Exact Mass | 525.10 |
| IUPAC Name | 1-[(3-chlorophenoxy)methyl]-N-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]pyrazole-3-carboxamide |
| SMILES | Cc1nn(Cc2c(F)c(F)c(F)c(F)c2F)c(C)c1NC(=O)c1ccn(COc2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C23H17ClF5N5O2/c1-11-22(12(2)34(31-11)9-15-17(25)19(27)21(29)20(28)18(15)26)30-23(35)16-6-7-33(32-16)10-36-14-5-3-4-13(24)8-14/h3-8H,9-10H2,1-2H3,(H,30,35) |
| InChIKey | KAPZWSNSDZKIFU-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 73.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.87 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|