C16H19ClFN3O — CID 19402868
N-[1-[(2-chloro-4-fluorophenyl)methyl]pyrazol-3-yl]-2-ethylbutanamide (PubChem CID 19402868) has the molecular formula C16H19ClFN3O and a molecular weight of 323.80 g/mol. Its IUPAC name is N-[1-[(2-chloro-4-fluorophenyl)methyl]pyrazol-3-yl]-2-ethylbutanamide.
| Compound Name | N-[1-[(2-chloro-4-fluorophenyl)methyl]pyrazol-3-yl]-2-ethylbutanamide |
|---|---|
| PubChem CID | 19402868 |
| Molecular Formula | C16H19ClFN3O |
| Molecular Weight | 323.80 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | N-[1-[(2-chloro-4-fluorophenyl)methyl]pyrazol-3-yl]-2-ethylbutanamide |
| SMILES | CCC(CC)C(=O)Nc1ccn(Cc2ccc(F)cc2Cl)n1 |
| InChI | InChI=1S/C16H19ClFN3O/c1-3-11(4-2)16(22)19-15-7-8-21(20-15)10-12-5-6-13(18)9-14(12)17/h5-9,11H,3-4,10H2,1-2H3,(H,19,20,22) |
| InChIKey | RTYCTJVQRVOGDI-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.80 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |