About N-[1-[(4-bromophenyl)methyl]pyrazol-4-yl]-2,2,2-trifluoroacetamide
N-[1-[(4-bromophenyl)methyl]pyrazol-4-yl]-2,2,2-trifluoroacetamide (PubChem CID 19403956) has the molecular formula C12H9BrF3N3O
and a molecular weight of 348.12 g/mol. Its IUPAC name is N-[1-[(4-bromophenyl)methyl]pyrazol-4-yl]-2,2,2-trifluoroacetamide.
Molecular Properties
| Compound Name | N-[1-[(4-bromophenyl)methyl]pyrazol-4-yl]-2,2,2-trifluoroacetamide |
| PubChem CID | 19403956 |
| Molecular Formula | C12H9BrF3N3O |
| Molecular Weight | 348.12 g/mol |
| Exact Mass | 346.99 |
| IUPAC Name | N-[1-[(4-bromophenyl)methyl]pyrazol-4-yl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(Nc1cnn(Cc2ccc(Br)cc2)c1)C(F)(F)F |
| InChI | InChI=1S/C12H9BrF3N3O/c13-9-3-1-8(2-4-9)6-19-7-10(5-17-19)18-11(20)12(14,15)16/h1-5,7H,6H2,(H,18,20) |
| InChIKey | AUVWIYBONQCFCS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.12 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[1-[(4-bromophenyl)methyl]pyrazol-4-yl]-2,2,2-trifluoroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[(4-bromophenyl)methyl]pyrazol-4-yl]-2,2,2-trifluoroacetamide?
The IUPAC name of N-[1-[(4-bromophenyl)methyl]pyrazol-4-yl]-2,2,2-trifluoroacetamide (CID 19403956) is N-[1-[(4-bromophenyl)methyl]pyrazol-4-yl]-2,2,2-trifluoroacetamide.
What is the SMILES notation for N-[1-[(4-bromophenyl)methyl]pyrazol-4-yl]-2,2,2-trifluoroacetamide?
The canonical SMILES for N-[1-[(4-bromophenyl)methyl]pyrazol-4-yl]-2,2,2-trifluoroacetamide is O=C(Nc1cnn(Cc2ccc(Br)cc2)c1)C(F)(F)F.
What is the InChIKey of N-[1-[(4-bromophenyl)methyl]pyrazol-4-yl]-2,2,2-trifluoroacetamide?
The InChIKey is AUVWIYBONQCFCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9BrF3N3O/c13-9-3-1-8(2-4-9)6-19-7-10(5-17-19)18-11(20)12(14,15)16/h1-5,7H,6H2,(H,18,20).
What are the key properties of N-[1-[(4-bromophenyl)methyl]pyrazol-4-yl]-2,2,2-trifluoroacetamide?
N-[1-[(4-bromophenyl)methyl]pyrazol-4-yl]-2,2,2-trifluoroacetamide has a molecular weight of 348.12 g/mol, XLogP of 3.19, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[(4-bromophenyl)methyl]pyrazol-4-yl]-2,2,2-trifluoroacetamide is sourced from PubChem (CID 19403956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).