About propan-2-yl 1-ethyl-4-[(2,2,2-trifluoroacetyl)amino]pyrazole-3-carboxylate
propan-2-yl 1-ethyl-4-[(2,2,2-trifluoroacetyl)amino]pyrazole-3-carboxylate (PubChem CID 19404447) has the molecular formula C11H14F3N3O3
and a molecular weight of 293.25 g/mol. Its IUPAC name is propan-2-yl 1-ethyl-4-[(2,2,2-trifluoroacetyl)amino]pyrazole-3-carboxylate.
Molecular Properties
| Compound Name | propan-2-yl 1-ethyl-4-[(2,2,2-trifluoroacetyl)amino]pyrazole-3-carboxylate |
| PubChem CID | 19404447 |
| Molecular Formula | C11H14F3N3O3 |
| Molecular Weight | 293.25 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | propan-2-yl 1-ethyl-4-[(2,2,2-trifluoroacetyl)amino]pyrazole-3-carboxylate |
| SMILES | CCn1cc(NC(=O)C(F)(F)F)c(C(=O)OC(C)C)n1 |
| InChI | InChI=1S/C11H14F3N3O3/c1-4-17-5-7(15-10(19)11(12,13)14)8(16-17)9(18)20-6(2)3/h5-6H,4H2,1-3H3,(H,15,19) |
| InChIKey | PCMPSYHTNOSUOF-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.25 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze propan-2-yl 1-ethyl-4-[(2,2,2-trifluoroacetyl)amino]pyrazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 1-ethyl-4-[(2,2,2-trifluoroacetyl)amino]pyrazole-3-carboxylate?
The IUPAC name of propan-2-yl 1-ethyl-4-[(2,2,2-trifluoroacetyl)amino]pyrazole-3-carboxylate (CID 19404447) is propan-2-yl 1-ethyl-4-[(2,2,2-trifluoroacetyl)amino]pyrazole-3-carboxylate.
What is the SMILES notation for propan-2-yl 1-ethyl-4-[(2,2,2-trifluoroacetyl)amino]pyrazole-3-carboxylate?
The canonical SMILES for propan-2-yl 1-ethyl-4-[(2,2,2-trifluoroacetyl)amino]pyrazole-3-carboxylate is CCn1cc(NC(=O)C(F)(F)F)c(C(=O)OC(C)C)n1.
What is the InChIKey of propan-2-yl 1-ethyl-4-[(2,2,2-trifluoroacetyl)amino]pyrazole-3-carboxylate?
The InChIKey is PCMPSYHTNOSUOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14F3N3O3/c1-4-17-5-7(15-10(19)11(12,13)14)8(16-17)9(18)20-6(2)3/h5-6H,4H2,1-3H3,(H,15,19).
What are the key properties of propan-2-yl 1-ethyl-4-[(2,2,2-trifluoroacetyl)amino]pyrazole-3-carboxylate?
propan-2-yl 1-ethyl-4-[(2,2,2-trifluoroacetyl)amino]pyrazole-3-carboxylate has a molecular weight of 293.25 g/mol, XLogP of 1.97, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 1-ethyl-4-[(2,2,2-trifluoroacetyl)amino]pyrazole-3-carboxylate is sourced from PubChem (CID 19404447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).