C13H14F7N3O3 — CID 19404452
propan-2-yl 1-ethyl-4-(2,2,3,3,4,4,4-heptafluorobutanoylamino)pyrazole-3-carboxylate (PubChem CID 19404452) has the molecular formula C13H14F7N3O3 and a molecular weight of 393.26 g/mol. Its IUPAC name is propan-2-yl 1-ethyl-4-(2,2,3,3,4,4,4-heptafluorobutanoylamino)pyrazole-3-carboxylate.
| Compound Name | propan-2-yl 1-ethyl-4-(2,2,3,3,4,4,4-heptafluorobutanoylamino)pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 19404452 |
| Molecular Formula | C13H14F7N3O3 |
| Molecular Weight | 393.26 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | propan-2-yl 1-ethyl-4-(2,2,3,3,4,4,4-heptafluorobutanoylamino)pyrazole-3-carboxylate |
| SMILES | CCn1cc(NC(=O)C(F)(F)C(F)(F)C(F)(F)F)c(C(=O)OC(C)C)n1 |
| InChI | InChI=1S/C13H14F7N3O3/c1-4-23-5-7(8(22-23)9(24)26-6(2)3)21-10(25)11(14,15)12(16,17)13(18,19)20/h5-6H,4H2,1-3H3,(H,21,25) |
| InChIKey | UHNNZERNJQLPJM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.26 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|