C21H24N6O5 — CID 19406849
methyl 2-[[3,5-dimethyl-4-[2-(4-nitropyrazol-1-yl)butanoylamino]pyrazol-1-yl]methyl]benzoate (PubChem CID 19406849) has the molecular formula C21H24N6O5 and a molecular weight of 440.46 g/mol. Its IUPAC name is methyl 2-[[3,5-dimethyl-4-[2-(4-nitropyrazol-1-yl)butanoylamino]pyrazol-1-yl]methyl]benzoate.
| Compound Name | methyl 2-[[3,5-dimethyl-4-[2-(4-nitropyrazol-1-yl)butanoylamino]pyrazol-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 19406849 |
| Molecular Formula | C21H24N6O5 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | methyl 2-[[3,5-dimethyl-4-[2-(4-nitropyrazol-1-yl)butanoylamino]pyrazol-1-yl]methyl]benzoate |
| SMILES | CCC(C(=O)Nc1c(C)nn(Cc2ccccc2C(=O)OC)c1C)n1cc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C21H24N6O5/c1-5-18(26-12-16(10-22-26)27(30)31)20(28)23-19-13(2)24-25(14(19)3)11-15-8-6-7-9-17(15)21(29)32-4/h6-10,12,18H,5,11H2,1-4H3,(H,23,28) |
| InChIKey | VEXJKYMPFLSTOS-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 134.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|