C22H25Cl2N3O — CID 19407190
2-(1-adamantyl)-N-[4-chloro-1-[(4-chlorophenyl)methyl]pyrazol-3-yl]acetamide (PubChem CID 19407190) has the molecular formula C22H25Cl2N3O and a molecular weight of 418.37 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-[4-chloro-1-[(4-chlorophenyl)methyl]pyrazol-3-yl]acetamide.
| Compound Name | 2-(1-adamantyl)-N-[4-chloro-1-[(4-chlorophenyl)methyl]pyrazol-3-yl]acetamide |
|---|---|
| PubChem CID | 19407190 |
| Molecular Formula | C22H25Cl2N3O |
| Molecular Weight | 418.37 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 2-(1-adamantyl)-N-[4-chloro-1-[(4-chlorophenyl)methyl]pyrazol-3-yl]acetamide |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)Nc1nn(Cc2ccc(Cl)cc2)cc1Cl |
| InChI | InChI=1S/C22H25Cl2N3O/c23-18-3-1-14(2-4-18)12-27-13-19(24)21(26-27)25-20(28)11-22-8-15-5-16(9-22)7-17(6-15)10-22/h1-4,13,15-17H,5-12H2,(H,25,26,28) |
| InChIKey | DYKQHVSCIPPEOM-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.37 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |