C19H17Cl2N3O2 — CID 19407215
N-[4-chloro-1-[(4-chlorophenyl)methyl]pyrazol-3-yl]-4-ethoxybenzamide (PubChem CID 19407215) has the molecular formula C19H17Cl2N3O2 and a molecular weight of 390.27 g/mol. Its IUPAC name is N-[4-chloro-1-[(4-chlorophenyl)methyl]pyrazol-3-yl]-4-ethoxybenzamide.
| Compound Name | N-[4-chloro-1-[(4-chlorophenyl)methyl]pyrazol-3-yl]-4-ethoxybenzamide |
|---|---|
| PubChem CID | 19407215 |
| Molecular Formula | C19H17Cl2N3O2 |
| Molecular Weight | 390.27 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | N-[4-chloro-1-[(4-chlorophenyl)methyl]pyrazol-3-yl]-4-ethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)Nc2nn(Cc3ccc(Cl)cc3)cc2Cl)cc1 |
| InChI | InChI=1S/C19H17Cl2N3O2/c1-2-26-16-9-5-14(6-10-16)19(25)22-18-17(21)12-24(23-18)11-13-3-7-15(20)8-4-13/h3-10,12H,2,11H2,1H3,(H,22,23,25) |
| InChIKey | JICVDSOVFHTMIH-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.27 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |